C24H22F2N2O5 — CID 165471465
3-[[4-(9H-fluoren-9-ylmethoxycarbonylamino)cyclopent-2-ene-1-carbonyl]amino]-2,2-difluoropropanoic acid (PubChem CID 165471465) has the molecular formula C24H22F2N2O5 and a molecular weight of 456.45 g/mol. Its IUPAC name is 3-[[4-(9H-fluoren-9-ylmethoxycarbonylamino)cyclopent-2-ene-1-carbonyl]amino]-2,2-difluoropropanoic acid.
| Compound Name | 3-[[4-(9H-fluoren-9-ylmethoxycarbonylamino)cyclopent-2-ene-1-carbonyl]amino]-2,2-difluoropropanoic acid |
|---|---|
| PubChem CID | 165471465 |
| Molecular Formula | C24H22F2N2O5 |
| Molecular Weight | 456.45 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | 3-[[4-(9H-fluoren-9-ylmethoxycarbonylamino)cyclopent-2-ene-1-carbonyl]amino]-2,2-difluoropropanoic acid |
| SMILES | O=C(NC1C=CC(C(=O)NCC(F)(F)C(=O)O)C1)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C24H22F2N2O5/c25-24(26,22(30)31)13-27-21(29)14-9-10-15(11-14)28-23(32)33-12-20-18-7-3-1-5-16(18)17-6-2-4-8-19(17)20/h1-10,14-15,20H,11-13H2,(H,27,29)(H,28,32)(H,30,31) |
| InChIKey | OVTFUNMHKDMVJE-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.45 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|