C28H30N2O5 — CID 178194929
(3R,4R)-1-[4-(9H-fluoren-9-ylmethoxycarbonylamino)cyclopent-2-ene-1-carbonyl]-3,4-dimethylpyrrolidine-3-carboxylic acid (PubChem CID 178194929) has the molecular formula C28H30N2O5 and a molecular weight of 474.56 g/mol. Its IUPAC name is (3R,4R)-1-[4-(9H-fluoren-9-ylmethoxycarbonylamino)cyclopent-2-ene-1-carbonyl]-3,4-dimethylpyrrolidine-3-carboxylic acid.
| Compound Name | (3R,4R)-1-[4-(9H-fluoren-9-ylmethoxycarbonylamino)cyclopent-2-ene-1-carbonyl]-3,4-dimethylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 178194929 |
| Molecular Formula | C28H30N2O5 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | (3R,4R)-1-[4-(9H-fluoren-9-ylmethoxycarbonylamino)cyclopent-2-ene-1-carbonyl]-3,4-dimethylpyrrolidine-3-carboxylic acid |
| SMILES | C[C@H]1CN(C(=O)C2C=CC(NC(=O)OCC3c4ccccc4-c4ccccc43)C2)C[C@]1(C)C(=O)O |
| InChI | InChI=1S/C28H30N2O5/c1-17-14-30(16-28(17,2)26(32)33)25(31)18-11-12-19(13-18)29-27(34)35-15-24-22-9-5-3-7-20(22)21-8-4-6-10-23(21)24/h3-12,17-19,24H,13-16H2,1-2H3,(H,29,34)(H,32,33)/t17-,18?,19?,28-/m0/s1 |
| InChIKey | OKFJLCGYPSHDBK-GBHFIZDQSA-N |
| XLogP | 4.04 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|