C27H30N2O5 — CID 178198526
(3R,4R)-1-[2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-enoyl]-3,4-dimethylpyrrolidine-3-carboxylic acid (PubChem CID 178198526) has the molecular formula C27H30N2O5 and a molecular weight of 462.55 g/mol. Its IUPAC name is (3R,4R)-1-[2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-enoyl]-3,4-dimethylpyrrolidine-3-carboxylic acid.
| Compound Name | (3R,4R)-1-[2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-enoyl]-3,4-dimethylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 178198526 |
| Molecular Formula | C27H30N2O5 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | (3R,4R)-1-[2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-enoyl]-3,4-dimethylpyrrolidine-3-carboxylic acid |
| SMILES | C=CCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)N1C[C@H](C)[C@@](C)(C(=O)O)C1 |
| InChI | InChI=1S/C27H30N2O5/c1-4-9-23(24(30)29-14-17(2)27(3,16-29)25(31)32)28-26(33)34-15-22-20-12-7-5-10-18(20)19-11-6-8-13-21(19)22/h4-8,10-13,17,22-23H,1,9,14-16H2,2-3H3,(H,28,33)(H,31,32)/t17-,23?,27-/m0/s1 |
| InChIKey | NPUFILIKOWUTAZ-UNPBGGOKSA-N |
| XLogP | 4.04 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|