C8H16N2O2S — CID 165485789
5-ethyl-6,6-dioxo-6λ6-thia-5-azaspiro[3.4]octan-8-amine (PubChem CID 165485789) has the molecular formula C8H16N2O2S and a molecular weight of 204.29 g/mol. Its IUPAC name is 5-ethyl-6,6-dioxo-6λ6-thia-5-azaspiro[3.4]octan-8-amine.
| Compound Name | 5-ethyl-6,6-dioxo-6λ6-thia-5-azaspiro[3.4]octan-8-amine |
|---|---|
| PubChem CID | 165485789 |
| Molecular Formula | C8H16N2O2S |
| Molecular Weight | 204.29 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 5-ethyl-6,6-dioxo-6λ6-thia-5-azaspiro[3.4]octan-8-amine |
| SMILES | CCN1C2(CCC2)C(N)CS1(=O)=O |
| InChI | InChI=1S/C8H16N2O2S/c1-2-10-8(4-3-5-8)7(9)6-13(10,11)12/h7H,2-6,9H2,1H3 |
| InChIKey | QXHRRSDFFFDEEV-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.29 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |