C6H10ClF2NO2S — CID 165496948
4,4-difluoro-3-methylpiperidine-1-sulfonyl chloride (PubChem CID 165496948) has the molecular formula C6H10ClF2NO2S and a molecular weight of 233.67 g/mol. Its IUPAC name is 4,4-difluoro-3-methylpiperidine-1-sulfonyl chloride.
| Compound Name | 4,4-difluoro-3-methylpiperidine-1-sulfonyl chloride |
|---|---|
| PubChem CID | 165496948 |
| Molecular Formula | C6H10ClF2NO2S |
| Molecular Weight | 233.67 g/mol |
| Exact Mass | 233.01 |
| IUPAC Name | 4,4-difluoro-3-methylpiperidine-1-sulfonyl chloride |
| SMILES | CC1CN(S(=O)(=O)Cl)CCC1(F)F |
| InChI | InChI=1S/C6H10ClF2NO2S/c1-5-4-10(13(7,11)12)3-2-6(5,8)9/h5H,2-4H2,1H3 |
| InChIKey | LFMCELUOESLPNL-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.67 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |