C9H6F3N3 — CID 165499340
5-(2,3-difluorophenyl)-4-fluoro-1H-pyrazol-3-amine (PubChem CID 165499340) has the molecular formula C9H6F3N3 and a molecular weight of 213.16 g/mol. Its IUPAC name is 5-(2,3-difluorophenyl)-4-fluoro-1H-pyrazol-3-amine.
| Compound Name | 5-(2,3-difluorophenyl)-4-fluoro-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 165499340 |
| Molecular Formula | C9H6F3N3 |
| Molecular Weight | 213.16 g/mol |
| Exact Mass | 213.05 |
| IUPAC Name | 5-(2,3-difluorophenyl)-4-fluoro-1H-pyrazol-3-amine |
| SMILES | Nc1n[nH]c(-c2cccc(F)c2F)c1F |
| InChI | InChI=1S/C9H6F3N3/c10-5-3-1-2-4(6(5)11)8-7(12)9(13)15-14-8/h1-3H,(H3,13,14,15) |
| InChIKey | MKMIKVSIEXKWRL-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.16 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |