C10H9BrFN3 — CID 165499401
5-(2-bromo-6-methylphenyl)-4-fluoro-1H-pyrazol-3-amine (PubChem CID 165499401) has the molecular formula C10H9BrFN3 and a molecular weight of 270.10 g/mol. Its IUPAC name is 5-(2-bromo-6-methylphenyl)-4-fluoro-1H-pyrazol-3-amine.
| Compound Name | 5-(2-bromo-6-methylphenyl)-4-fluoro-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 165499401 |
| Molecular Formula | C10H9BrFN3 |
| Molecular Weight | 270.10 g/mol |
| Exact Mass | 269.00 |
| IUPAC Name | 5-(2-bromo-6-methylphenyl)-4-fluoro-1H-pyrazol-3-amine |
| SMILES | Cc1cccc(Br)c1-c1[nH]nc(N)c1F |
| InChI | InChI=1S/C10H9BrFN3/c1-5-3-2-4-6(11)7(5)9-8(12)10(13)15-14-9/h2-4H,1H3,(H3,13,14,15) |
| InChIKey | YXVXYGASGQVILA-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.10 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |