C14H7BrClNO2S — CID 16551335
(2-bromo-4-chlorophenyl) 1,3-benzothiazole-6-carboxylate (PubChem CID 16551335) has the molecular formula C14H7BrClNO2S and a molecular weight of 368.64 g/mol. Its IUPAC name is (2-bromo-4-chlorophenyl) 1,3-benzothiazole-6-carboxylate.
| Compound Name | (2-bromo-4-chlorophenyl) 1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 16551335 |
| Molecular Formula | C14H7BrClNO2S |
| Molecular Weight | 368.64 g/mol |
| Exact Mass | 366.91 |
| IUPAC Name | (2-bromo-4-chlorophenyl) 1,3-benzothiazole-6-carboxylate |
| SMILES | O=C(Oc1ccc(Cl)cc1Br)c1ccc2ncsc2c1 |
| InChI | InChI=1S/C14H7BrClNO2S/c15-10-6-9(16)2-4-12(10)19-14(18)8-1-3-11-13(5-8)20-7-17-11/h1-7H |
| InChIKey | MPHYWLZLIIHAFJ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.64 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|