C25H26N4O2S — CID 16553286
2-(morpholin-4-ylmethyl)-N-(2-phenoxyethyl)-5-phenylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 16553286) has the molecular formula C25H26N4O2S and a molecular weight of 446.58 g/mol. Its IUPAC name is 2-(morpholin-4-ylmethyl)-N-(2-phenoxyethyl)-5-phenylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-(morpholin-4-ylmethyl)-N-(2-phenoxyethyl)-5-phenylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 16553286 |
| Molecular Formula | C25H26N4O2S |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | 2-(morpholin-4-ylmethyl)-N-(2-phenoxyethyl)-5-phenylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | c1ccc(OCCNc2nc(CN3CCOCC3)nc3scc(-c4ccccc4)c23)cc1 |
| InChI | InChI=1S/C25H26N4O2S/c1-3-7-19(8-4-1)21-18-32-25-23(21)24(26-11-14-31-20-9-5-2-6-10-20)27-22(28-25)17-29-12-15-30-16-13-29/h1-10,18H,11-17H2,(H,26,27,28) |
| InChIKey | IZGGCCKOVXPZGA-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|