C24H24N4OS — CID 2481763
N-benzyl-2-(morpholin-4-ylmethyl)-5-phenylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 2481763) has the molecular formula C24H24N4OS and a molecular weight of 416.55 g/mol. Its IUPAC name is N-benzyl-2-(morpholin-4-ylmethyl)-5-phenylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-benzyl-2-(morpholin-4-ylmethyl)-5-phenylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 2481763 |
| Molecular Formula | C24H24N4OS |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | N-benzyl-2-(morpholin-4-ylmethyl)-5-phenylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | c1ccc(CNc2nc(CN3CCOCC3)nc3scc(-c4ccccc4)c23)cc1 |
| InChI | InChI=1S/C24H24N4OS/c1-3-7-18(8-4-1)15-25-23-22-20(19-9-5-2-6-10-19)17-30-24(22)27-21(26-23)16-28-11-13-29-14-12-28/h1-10,17H,11-16H2,(H,25,26,27) |
| InChIKey | BMOPRBOSAXRYIX-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |