C20H24N4OS — CID 9280306
2-methyl-N-(3-morpholin-4-ylpropyl)-5-phenylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 9280306) has the molecular formula C20H24N4OS and a molecular weight of 368.51 g/mol. Its IUPAC name is 2-methyl-N-(3-morpholin-4-ylpropyl)-5-phenylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-methyl-N-(3-morpholin-4-ylpropyl)-5-phenylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 9280306 |
| Molecular Formula | C20H24N4OS |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 2-methyl-N-(3-morpholin-4-ylpropyl)-5-phenylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1nc(NCCCN2CCOCC2)c2c(-c3ccccc3)csc2n1 |
| InChI | InChI=1S/C20H24N4OS/c1-15-22-19(21-8-5-9-24-10-12-25-13-11-24)18-17(14-26-20(18)23-15)16-6-3-2-4-7-16/h2-4,6-7,14H,5,8-13H2,1H3,(H,21,22,23) |
| InChIKey | MAOWFVACSGFKFO-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|