C19H21N3S — CID 16553299
N-cyclohexyl-N-methyl-6-phenylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 16553299) has the molecular formula C19H21N3S and a molecular weight of 323.46 g/mol. Its IUPAC name is N-cyclohexyl-N-methyl-6-phenylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-cyclohexyl-N-methyl-6-phenylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 16553299 |
| Molecular Formula | C19H21N3S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | N-cyclohexyl-N-methyl-6-phenylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | CN(c1ncnc2sc(-c3ccccc3)cc12)C1CCCCC1 |
| InChI | InChI=1S/C19H21N3S/c1-22(15-10-6-3-7-11-15)18-16-12-17(14-8-4-2-5-9-14)23-19(16)21-13-20-18/h2,4-5,8-9,12-13,15H,3,6-7,10-11H2,1H3 |
| InChIKey | FUKPWHACXVPVMF-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |