C23H31N5O4S2 — CID 16556177
1-[(E)-[2,5-dimethyl-1-(3-morpholin-4-ylsulfonylphenyl)pyrrol-3-yl]methylideneamino]-3-(oxolan-2-ylmethyl)thiourea (PubChem CID 16556177) has the molecular formula C23H31N5O4S2 and a molecular weight of 505.67 g/mol. Its IUPAC name is 1-[(E)-[2,5-dimethyl-1-(3-morpholin-4-ylsulfonylphenyl)pyrrol-3-yl]methylideneamino]-3-(oxolan-2-ylmethyl)thiourea.
| Compound Name | 1-[(E)-[2,5-dimethyl-1-(3-morpholin-4-ylsulfonylphenyl)pyrrol-3-yl]methylideneamino]-3-(oxolan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 16556177 |
| Molecular Formula | C23H31N5O4S2 |
| Molecular Weight | 505.67 g/mol |
| Exact Mass | 505.18 |
| IUPAC Name | 1-[(E)-[2,5-dimethyl-1-(3-morpholin-4-ylsulfonylphenyl)pyrrol-3-yl]methylideneamino]-3-(oxolan-2-ylmethyl)thiourea |
| SMILES | Cc1cc(/C=N/NC(=S)NCC2CCCO2)c(C)n1-c1cccc(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C23H31N5O4S2/c1-17-13-19(15-25-26-23(33)24-16-21-6-4-10-32-21)18(2)28(17)20-5-3-7-22(14-20)34(29,30)27-8-11-31-12-9-27/h3,5,7,13-15,21H,4,6,8-12,16H2,1-2H3,(H2,24,26,33)/b25-15+ |
| InChIKey | RPQFZPQEBCECSZ-MFKUBSTISA-N |
| XLogP | 2.09 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.67 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|