C23H28N6O3S — CID 41081856
N-[(Z)-[2,5-dimethyl-1-(3-morpholin-4-ylsulfonylphenyl)pyrrol-3-yl]methylideneamino]-4,6-dimethylpyrimidin-2-amine (PubChem CID 41081856) has the molecular formula C23H28N6O3S and a molecular weight of 468.58 g/mol. Its IUPAC name is N-[(Z)-[2,5-dimethyl-1-(3-morpholin-4-ylsulfonylphenyl)pyrrol-3-yl]methylideneamino]-4,6-dimethylpyrimidin-2-amine.
| Compound Name | N-[(Z)-[2,5-dimethyl-1-(3-morpholin-4-ylsulfonylphenyl)pyrrol-3-yl]methylideneamino]-4,6-dimethylpyrimidin-2-amine |
|---|---|
| PubChem CID | 41081856 |
| Molecular Formula | C23H28N6O3S |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | N-[(Z)-[2,5-dimethyl-1-(3-morpholin-4-ylsulfonylphenyl)pyrrol-3-yl]methylideneamino]-4,6-dimethylpyrimidin-2-amine |
| SMILES | Cc1cc(C)nc(N/N=C\c2cc(C)n(-c3cccc(S(=O)(=O)N4CCOCC4)c3)c2C)n1 |
| InChI | InChI=1S/C23H28N6O3S/c1-16-12-17(2)26-23(25-16)27-24-15-20-13-18(3)29(19(20)4)21-6-5-7-22(14-21)33(30,31)28-8-10-32-11-9-28/h5-7,12-15H,8-11H2,1-4H3,(H,25,26,27)/b24-15- |
| InChIKey | PAKHDDGPYGBIRT-IWIPYMOSSA-N |
| XLogP | 2.97 |
| TPSA | 101.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|