C25H36N6O4S2 — CID 167781824
1-[(E)-[2,5-dimethyl-1-(5-morpholin-4-ylsulfonyl-2-pyrrolidin-1-ylphenyl)pyrrol-3-yl]methylideneamino]-3-(2-methoxyethyl)thiourea (PubChem CID 167781824) has the molecular formula C25H36N6O4S2 and a molecular weight of 548.74 g/mol. Its IUPAC name is 1-[(E)-[2,5-dimethyl-1-(5-morpholin-4-ylsulfonyl-2-pyrrolidin-1-ylphenyl)pyrrol-3-yl]methylideneamino]-3-(2-methoxyethyl)thiourea.
| Compound Name | 1-[(E)-[2,5-dimethyl-1-(5-morpholin-4-ylsulfonyl-2-pyrrolidin-1-ylphenyl)pyrrol-3-yl]methylideneamino]-3-(2-methoxyethyl)thiourea |
|---|---|
| PubChem CID | 167781824 |
| Molecular Formula | C25H36N6O4S2 |
| Molecular Weight | 548.74 g/mol |
| Exact Mass | 548.22 |
| IUPAC Name | 1-[(E)-[2,5-dimethyl-1-(5-morpholin-4-ylsulfonyl-2-pyrrolidin-1-ylphenyl)pyrrol-3-yl]methylideneamino]-3-(2-methoxyethyl)thiourea |
| SMILES | COCCNC(=S)N/N=C/c1cc(C)n(-c2cc(S(=O)(=O)N3CCOCC3)ccc2N2CCCC2)c1C |
| InChI | InChI=1S/C25H36N6O4S2/c1-19-16-21(18-27-28-25(36)26-8-13-34-3)20(2)31(19)24-17-22(6-7-23(24)29-9-4-5-10-29)37(32,33)30-11-14-35-15-12-30/h6-7,16-18H,4-5,8-15H2,1-3H3,(H2,26,28,36)/b27-18+ |
| InChIKey | MOJSUQGZRFOCDW-OVVQPSECSA-N |
| XLogP | 2.16 |
| TPSA | 100.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.74 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|