C29H39N5O5S — CID 3530762
2-cyano-3-[2,5-dimethyl-1-(5-morpholin-4-ylsulfonyl-2-pyrrolidin-1-ylphenyl)pyrrol-3-yl]-N-(3-ethoxypropyl)prop-2-enamide (PubChem CID 3530762) has the molecular formula C29H39N5O5S and a molecular weight of 569.73 g/mol. Its IUPAC name is 2-cyano-3-[2,5-dimethyl-1-(5-morpholin-4-ylsulfonyl-2-pyrrolidin-1-ylphenyl)pyrrol-3-yl]-N-(3-ethoxypropyl)prop-2-enamide.
| Compound Name | 2-cyano-3-[2,5-dimethyl-1-(5-morpholin-4-ylsulfonyl-2-pyrrolidin-1-ylphenyl)pyrrol-3-yl]-N-(3-ethoxypropyl)prop-2-enamide |
|---|---|
| PubChem CID | 3530762 |
| Molecular Formula | C29H39N5O5S |
| Molecular Weight | 569.73 g/mol |
| Exact Mass | 569.27 |
| IUPAC Name | 2-cyano-3-[2,5-dimethyl-1-(5-morpholin-4-ylsulfonyl-2-pyrrolidin-1-ylphenyl)pyrrol-3-yl]-N-(3-ethoxypropyl)prop-2-enamide |
| SMILES | CCOCCCNC(=O)C(C#N)=Cc1cc(C)n(-c2cc(S(=O)(=O)N3CCOCC3)ccc2N2CCCC2)c1C |
| InChI | InChI=1S/C29H39N5O5S/c1-4-38-15-7-10-31-29(35)25(21-30)19-24-18-22(2)34(23(24)3)28-20-26(8-9-27(28)32-11-5-6-12-32)40(36,37)33-13-16-39-17-14-33/h8-9,18-20H,4-7,10-17H2,1-3H3,(H,31,35) |
| InChIKey | XVGZBDLFTJOMLG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 116.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.73 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|