About Dimethyl[2-(1,4-oxazepan-2-yl)ethyl]amine
Dimethyl[2-(1,4-oxazepan-2-yl)ethyl]amine (PubChem CID 165590722) has the molecular formula C9H20N2O
and a molecular weight of 172.27 g/mol. Its IUPAC name is N,N-dimethyl-2-(1,4-oxazepan-2-yl)ethanamine.
Molecular Properties
| Compound Name | Dimethyl[2-(1,4-oxazepan-2-yl)ethyl]amine |
| PubChem CID | 165590722 |
| Molecular Formula | C9H20N2O |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.16 |
| IUPAC Name | N,N-dimethyl-2-(1,4-oxazepan-2-yl)ethanamine |
| SMILES | CN(C)CCC1CNCCCO1 |
| InChI | InChI=1S/C9H20N2O/c1-11(2)6-4-9-8-10-5-3-7-12-9/h9-10H,3-8H2,1-2H3 |
| InChIKey | XTVQLFFTMWZXPO-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | 117 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze Dimethyl[2-(1,4-oxazepan-2-yl)ethyl]amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Dimethyl[2-(1,4-oxazepan-2-yl)ethyl]amine?
The IUPAC name of Dimethyl[2-(1,4-oxazepan-2-yl)ethyl]amine (CID 165590722) is N,N-dimethyl-2-(1,4-oxazepan-2-yl)ethanamine.
What is the SMILES notation for Dimethyl[2-(1,4-oxazepan-2-yl)ethyl]amine?
The canonical SMILES for Dimethyl[2-(1,4-oxazepan-2-yl)ethyl]amine is CN(C)CCC1CNCCCO1.
What is the InChIKey of Dimethyl[2-(1,4-oxazepan-2-yl)ethyl]amine?
The InChIKey is XTVQLFFTMWZXPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2O/c1-11(2)6-4-9-8-10-5-3-7-12-9/h9-10H,3-8H2,1-2H3.
What are the key properties of Dimethyl[2-(1,4-oxazepan-2-yl)ethyl]amine?
Dimethyl[2-(1,4-oxazepan-2-yl)ethyl]amine has a molecular weight of 172.27 g/mol, XLogP of 0.20, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Dimethyl[2-(1,4-oxazepan-2-yl)ethyl]amine is sourced from PubChem (CID 165590722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).