C25H20N2O4S2 — CID 16561331
[4-(1,3-dithiolan-2-yl)-2-methoxyphenyl] 4-oxo-3-phenylphthalazine-1-carboxylate (PubChem CID 16561331) has the molecular formula C25H20N2O4S2 and a molecular weight of 476.58 g/mol. Its IUPAC name is [4-(1,3-dithiolan-2-yl)-2-methoxyphenyl] 4-oxo-3-phenylphthalazine-1-carboxylate.
| Compound Name | [4-(1,3-dithiolan-2-yl)-2-methoxyphenyl] 4-oxo-3-phenylphthalazine-1-carboxylate |
|---|---|
| PubChem CID | 16561331 |
| Molecular Formula | C25H20N2O4S2 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.09 |
| IUPAC Name | [4-(1,3-dithiolan-2-yl)-2-methoxyphenyl] 4-oxo-3-phenylphthalazine-1-carboxylate |
| SMILES | COc1cc(C2SCCS2)ccc1OC(=O)c1nn(-c2ccccc2)c(=O)c2ccccc12 |
| InChI | InChI=1S/C25H20N2O4S2/c1-30-21-15-16(25-32-13-14-33-25)11-12-20(21)31-24(29)22-18-9-5-6-10-19(18)23(28)27(26-22)17-7-3-2-4-8-17/h2-12,15,25H,13-14H2,1H3 |
| InChIKey | HIPOQMJRLWZOSD-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|