C25H30N4O5S — CID 16566391
2-(2-methylindol-1-yl)-N-(2-morpholin-4-yl-5-morpholin-4-ylsulfonylphenyl)acetamide (PubChem CID 16566391) has the molecular formula C25H30N4O5S and a molecular weight of 498.61 g/mol. Its IUPAC name is 2-(2-methylindol-1-yl)-N-(2-morpholin-4-yl-5-morpholin-4-ylsulfonylphenyl)acetamide.
| Compound Name | 2-(2-methylindol-1-yl)-N-(2-morpholin-4-yl-5-morpholin-4-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 16566391 |
| Molecular Formula | C25H30N4O5S |
| Molecular Weight | 498.61 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | 2-(2-methylindol-1-yl)-N-(2-morpholin-4-yl-5-morpholin-4-ylsulfonylphenyl)acetamide |
| SMILES | Cc1cc2ccccc2n1CC(=O)Nc1cc(S(=O)(=O)N2CCOCC2)ccc1N1CCOCC1 |
| InChI | InChI=1S/C25H30N4O5S/c1-19-16-20-4-2-3-5-23(20)29(19)18-25(30)26-22-17-21(35(31,32)28-10-14-34-15-11-28)6-7-24(22)27-8-12-33-13-9-27/h2-7,16-17H,8-15,18H2,1H3,(H,26,30) |
| InChIKey | LMKKKNBXTNAIBA-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 93.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.61 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |