C24H29N3O6S — CID 16572435
N-[[1-(2,3-dihydro-1,4-benzodioxin-6-yl)cyclopentyl]methyl]-2-nitro-4-pyrrolidin-1-ylsulfonylaniline (PubChem CID 16572435) has the molecular formula C24H29N3O6S and a molecular weight of 487.58 g/mol. Its IUPAC name is N-[[1-(2,3-dihydro-1,4-benzodioxin-6-yl)cyclopentyl]methyl]-2-nitro-4-pyrrolidin-1-ylsulfonylaniline.
| Compound Name | N-[[1-(2,3-dihydro-1,4-benzodioxin-6-yl)cyclopentyl]methyl]-2-nitro-4-pyrrolidin-1-ylsulfonylaniline |
|---|---|
| PubChem CID | 16572435 |
| Molecular Formula | C24H29N3O6S |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | N-[[1-(2,3-dihydro-1,4-benzodioxin-6-yl)cyclopentyl]methyl]-2-nitro-4-pyrrolidin-1-ylsulfonylaniline |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)N2CCCC2)ccc1NCC1(c2ccc3c(c2)OCCO3)CCCC1 |
| InChI | InChI=1S/C24H29N3O6S/c28-27(29)21-16-19(34(30,31)26-11-3-4-12-26)6-7-20(21)25-17-24(9-1-2-10-24)18-5-8-22-23(15-18)33-14-13-32-22/h5-8,15-16,25H,1-4,9-14,17H2 |
| InChIKey | VCIMGLLGWOVUMD-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|