C20H22FN3O5S — CID 133311481
N-[[1-(2-fluorophenyl)cyclopropyl]methyl]-4-morpholin-4-ylsulfonyl-2-nitroaniline (PubChem CID 133311481) has the molecular formula C20H22FN3O5S and a molecular weight of 435.48 g/mol. Its IUPAC name is N-[[1-(2-fluorophenyl)cyclopropyl]methyl]-4-morpholin-4-ylsulfonyl-2-nitroaniline.
| Compound Name | N-[[1-(2-fluorophenyl)cyclopropyl]methyl]-4-morpholin-4-ylsulfonyl-2-nitroaniline |
|---|---|
| PubChem CID | 133311481 |
| Molecular Formula | C20H22FN3O5S |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | N-[[1-(2-fluorophenyl)cyclopropyl]methyl]-4-morpholin-4-ylsulfonyl-2-nitroaniline |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)N2CCOCC2)ccc1NCC1(c2ccccc2F)CC1 |
| InChI | InChI=1S/C20H22FN3O5S/c21-17-4-2-1-3-16(17)20(7-8-20)14-22-18-6-5-15(13-19(18)24(25)26)30(27,28)23-9-11-29-12-10-23/h1-6,13,22H,7-12,14H2 |
| InChIKey | RVFHGULQEMASNP-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|