C23H26FN3O5S — CID 16574376
1-[3-fluoro-4-[4-(3-morpholin-4-ylsulfonylbenzoyl)piperazin-1-yl]phenyl]ethanone (PubChem CID 16574376) has the molecular formula C23H26FN3O5S and a molecular weight of 475.54 g/mol. Its IUPAC name is 1-[3-fluoro-4-[4-(3-morpholin-4-ylsulfonylbenzoyl)piperazin-1-yl]phenyl]ethanone.
| Compound Name | 1-[3-fluoro-4-[4-(3-morpholin-4-ylsulfonylbenzoyl)piperazin-1-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 16574376 |
| Molecular Formula | C23H26FN3O5S |
| Molecular Weight | 475.54 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | 1-[3-fluoro-4-[4-(3-morpholin-4-ylsulfonylbenzoyl)piperazin-1-yl]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(N2CCN(C(=O)c3cccc(S(=O)(=O)N4CCOCC4)c3)CC2)c(F)c1 |
| InChI | InChI=1S/C23H26FN3O5S/c1-17(28)18-5-6-22(21(24)16-18)25-7-9-26(10-8-25)23(29)19-3-2-4-20(15-19)33(30,31)27-11-13-32-14-12-27/h2-6,15-16H,7-14H2,1H3 |
| InChIKey | FCCHTJLCRIDRCM-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.54 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |