C20H19ClN4O6 — CID 16578280
[3-[2-(2-methoxyanilino)-2-oxoethyl]-1,2,4-oxadiazol-5-yl]methyl 4-amino-5-chloro-2-methoxybenzoate (PubChem CID 16578280) has the molecular formula C20H19ClN4O6 and a molecular weight of 446.85 g/mol. Its IUPAC name is [3-[2-(2-methoxyanilino)-2-oxoethyl]-1,2,4-oxadiazol-5-yl]methyl 4-amino-5-chloro-2-methoxybenzoate.
| Compound Name | [3-[2-(2-methoxyanilino)-2-oxoethyl]-1,2,4-oxadiazol-5-yl]methyl 4-amino-5-chloro-2-methoxybenzoate |
|---|---|
| PubChem CID | 16578280 |
| Molecular Formula | C20H19ClN4O6 |
| Molecular Weight | 446.85 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | [3-[2-(2-methoxyanilino)-2-oxoethyl]-1,2,4-oxadiazol-5-yl]methyl 4-amino-5-chloro-2-methoxybenzoate |
| SMILES | COc1ccccc1NC(=O)Cc1noc(COC(=O)c2cc(Cl)c(N)cc2OC)n1 |
| InChI | InChI=1S/C20H19ClN4O6/c1-28-15-6-4-3-5-14(15)23-18(26)9-17-24-19(31-25-17)10-30-20(27)11-7-12(21)13(22)8-16(11)29-2/h3-8H,9-10,22H2,1-2H3,(H,23,26) |
| InChIKey | VWVFBQBFIYCJHL-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 138.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.85 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|