C12H12ClN3O4 — CID 18147366
(3-methyl-1,2,4-oxadiazol-5-yl)methyl 4-amino-5-chloro-2-methoxybenzoate (PubChem CID 18147366) has the molecular formula C12H12ClN3O4 and a molecular weight of 297.70 g/mol. Its IUPAC name is (3-methyl-1,2,4-oxadiazol-5-yl)methyl 4-amino-5-chloro-2-methoxybenzoate.
| Compound Name | (3-methyl-1,2,4-oxadiazol-5-yl)methyl 4-amino-5-chloro-2-methoxybenzoate |
|---|---|
| PubChem CID | 18147366 |
| Molecular Formula | C12H12ClN3O4 |
| Molecular Weight | 297.70 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | (3-methyl-1,2,4-oxadiazol-5-yl)methyl 4-amino-5-chloro-2-methoxybenzoate |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)OCc1nc(C)no1 |
| InChI | InChI=1S/C12H12ClN3O4/c1-6-15-11(20-16-6)5-19-12(17)7-3-8(13)9(14)4-10(7)18-2/h3-4H,5,14H2,1-2H3 |
| InChIKey | KAZDCDRABGDDLG-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 100.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.70 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|