C23H23N3O6S — CID 16578761
[2-[2-[(5Z)-2,4-dioxo-5-(pyridin-3-ylmethylidene)-1,3-thiazolidin-3-yl]ethylamino]-2-oxoethyl] 3-(2-methoxyphenyl)propanoate (PubChem CID 16578761) has the molecular formula C23H23N3O6S and a molecular weight of 469.52 g/mol. Its IUPAC name is [2-[2-[(5Z)-2,4-dioxo-5-(pyridin-3-ylmethylidene)-1,3-thiazolidin-3-yl]ethylamino]-2-oxoethyl] 3-(2-methoxyphenyl)propanoate.
| Compound Name | [2-[2-[(5Z)-2,4-dioxo-5-(pyridin-3-ylmethylidene)-1,3-thiazolidin-3-yl]ethylamino]-2-oxoethyl] 3-(2-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 16578761 |
| Molecular Formula | C23H23N3O6S |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | [2-[2-[(5Z)-2,4-dioxo-5-(pyridin-3-ylmethylidene)-1,3-thiazolidin-3-yl]ethylamino]-2-oxoethyl] 3-(2-methoxyphenyl)propanoate |
| SMILES | COc1ccccc1CCC(=O)OCC(=O)NCCN1C(=O)S/C(=C\c2cccnc2)C1=O |
| InChI | InChI=1S/C23H23N3O6S/c1-31-18-7-3-2-6-17(18)8-9-21(28)32-15-20(27)25-11-12-26-22(29)19(33-23(26)30)13-16-5-4-10-24-14-16/h2-7,10,13-14H,8-9,11-12,15H2,1H3,(H,25,27)/b19-13- |
| InChIKey | WUTHQCMKDFSVTL-UYRXBGFRSA-N |
| XLogP | 2.42 |
| TPSA | 114.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|