C21H18N4O7S — CID 16578313
[2-[2-[(5Z)-2,4-dioxo-5-(pyridin-3-ylmethylidene)-1,3-thiazolidin-3-yl]ethylamino]-2-oxoethyl] 2-(2-nitrophenyl)acetate (PubChem CID 16578313) has the molecular formula C21H18N4O7S and a molecular weight of 470.46 g/mol. Its IUPAC name is [2-[2-[(5Z)-2,4-dioxo-5-(pyridin-3-ylmethylidene)-1,3-thiazolidin-3-yl]ethylamino]-2-oxoethyl] 2-(2-nitrophenyl)acetate.
| Compound Name | [2-[2-[(5Z)-2,4-dioxo-5-(pyridin-3-ylmethylidene)-1,3-thiazolidin-3-yl]ethylamino]-2-oxoethyl] 2-(2-nitrophenyl)acetate |
|---|---|
| PubChem CID | 16578313 |
| Molecular Formula | C21H18N4O7S |
| Molecular Weight | 470.46 g/mol |
| Exact Mass | 470.09 |
| IUPAC Name | [2-[2-[(5Z)-2,4-dioxo-5-(pyridin-3-ylmethylidene)-1,3-thiazolidin-3-yl]ethylamino]-2-oxoethyl] 2-(2-nitrophenyl)acetate |
| SMILES | O=C(COC(=O)Cc1ccccc1[N+](=O)[O-])NCCN1C(=O)S/C(=C\c2cccnc2)C1=O |
| InChI | InChI=1S/C21H18N4O7S/c26-18(13-32-19(27)11-15-5-1-2-6-16(15)25(30)31)23-8-9-24-20(28)17(33-21(24)29)10-14-4-3-7-22-12-14/h1-7,10,12H,8-9,11,13H2,(H,23,26)/b17-10- |
| InChIKey | KFCJIBIUPTWOBM-YVLHZVERSA-N |
| XLogP | 1.93 |
| TPSA | 148.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.46 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|