C24H24N4O6S — CID 16577653
[2-[2-[(5Z)-2,4-dioxo-5-(pyridin-3-ylmethylidene)-1,3-thiazolidin-3-yl]ethylamino]-2-oxoethyl] (2S)-2-[(3-methylbenzoyl)amino]propanoate (PubChem CID 16577653) has the molecular formula C24H24N4O6S and a molecular weight of 496.55 g/mol. Its IUPAC name is [2-[2-[(5Z)-2,4-dioxo-5-(pyridin-3-ylmethylidene)-1,3-thiazolidin-3-yl]ethylamino]-2-oxoethyl] (2S)-2-[(3-methylbenzoyl)amino]propanoate.
| Compound Name | [2-[2-[(5Z)-2,4-dioxo-5-(pyridin-3-ylmethylidene)-1,3-thiazolidin-3-yl]ethylamino]-2-oxoethyl] (2S)-2-[(3-methylbenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 16577653 |
| Molecular Formula | C24H24N4O6S |
| Molecular Weight | 496.55 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | [2-[2-[(5Z)-2,4-dioxo-5-(pyridin-3-ylmethylidene)-1,3-thiazolidin-3-yl]ethylamino]-2-oxoethyl] (2S)-2-[(3-methylbenzoyl)amino]propanoate |
| SMILES | Cc1cccc(C(=O)N[C@@H](C)C(=O)OCC(=O)NCCN2C(=O)S/C(=C\c3cccnc3)C2=O)c1 |
| InChI | InChI=1S/C24H24N4O6S/c1-15-5-3-7-18(11-15)21(30)27-16(2)23(32)34-14-20(29)26-9-10-28-22(31)19(35-24(28)33)12-17-6-4-8-25-13-17/h3-8,11-13,16H,9-10,14H2,1-2H3,(H,26,29)(H,27,30)/b19-12-/t16-/m0/s1 |
| InChIKey | ZTEBTQITEPCOJS-JJBLJPBOSA-N |
| XLogP | 1.90 |
| TPSA | 134.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.55 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|