C17H20FN3O3S — CID 16580079
N-[(4-fluoro-3-methylphenyl)methyl]-4-pyrrolidin-1-ylsulfonyl-1H-pyrrole-2-carboxamide (PubChem CID 16580079) has the molecular formula C17H20FN3O3S and a molecular weight of 365.43 g/mol. Its IUPAC name is N-[(4-fluoro-3-methylphenyl)methyl]-4-pyrrolidin-1-ylsulfonyl-1H-pyrrole-2-carboxamide.
| Compound Name | N-[(4-fluoro-3-methylphenyl)methyl]-4-pyrrolidin-1-ylsulfonyl-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 16580079 |
| Molecular Formula | C17H20FN3O3S |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | N-[(4-fluoro-3-methylphenyl)methyl]-4-pyrrolidin-1-ylsulfonyl-1H-pyrrole-2-carboxamide |
| SMILES | Cc1cc(CNC(=O)c2cc(S(=O)(=O)N3CCCC3)c[nH]2)ccc1F |
| InChI | InChI=1S/C17H20FN3O3S/c1-12-8-13(4-5-15(12)18)10-20-17(22)16-9-14(11-19-16)25(23,24)21-6-2-3-7-21/h4-5,8-9,11,19H,2-3,6-7,10H2,1H3,(H,20,22) |
| InChIKey | ZIPVFLMGSHQGTP-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |