C17H15NO5S — CID 16582580
(4-methoxycarbonylphenyl) 5-(cyclopropanecarbonylamino)thiophene-2-carboxylate (PubChem CID 16582580) has the molecular formula C17H15NO5S and a molecular weight of 345.38 g/mol. Its IUPAC name is (4-methoxycarbonylphenyl) 5-(cyclopropanecarbonylamino)thiophene-2-carboxylate.
| Compound Name | (4-methoxycarbonylphenyl) 5-(cyclopropanecarbonylamino)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 16582580 |
| Molecular Formula | C17H15NO5S |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | (4-methoxycarbonylphenyl) 5-(cyclopropanecarbonylamino)thiophene-2-carboxylate |
| SMILES | COC(=O)c1ccc(OC(=O)c2ccc(NC(=O)C3CC3)s2)cc1 |
| InChI | InChI=1S/C17H15NO5S/c1-22-16(20)11-4-6-12(7-5-11)23-17(21)13-8-9-14(24-13)18-15(19)10-2-3-10/h4-10H,2-3H2,1H3,(H,18,19) |
| InChIKey | XOHLIUBOKZRYRF-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|