C15H12BrNO3S — CID 86915162
(3-bromophenyl) 5-(cyclopropanecarbonylamino)thiophene-2-carboxylate (PubChem CID 86915162) has the molecular formula C15H12BrNO3S and a molecular weight of 366.24 g/mol. Its IUPAC name is (3-bromophenyl) 5-(cyclopropanecarbonylamino)thiophene-2-carboxylate.
| Compound Name | (3-bromophenyl) 5-(cyclopropanecarbonylamino)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 86915162 |
| Molecular Formula | C15H12BrNO3S |
| Molecular Weight | 366.24 g/mol |
| Exact Mass | 364.97 |
| IUPAC Name | (3-bromophenyl) 5-(cyclopropanecarbonylamino)thiophene-2-carboxylate |
| SMILES | O=C(Oc1cccc(Br)c1)c1ccc(NC(=O)C2CC2)s1 |
| InChI | InChI=1S/C15H12BrNO3S/c16-10-2-1-3-11(8-10)20-15(19)12-6-7-13(21-12)17-14(18)9-4-5-9/h1-3,6-9H,4-5H2,(H,17,18) |
| InChIKey | KKERUMARAVESKZ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.24 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|