C17H16FNO3S — CID 86937892
2-(4-fluorophenyl)ethyl 5-(cyclopropanecarbonylamino)thiophene-2-carboxylate (PubChem CID 86937892) has the molecular formula C17H16FNO3S and a molecular weight of 333.38 g/mol. Its IUPAC name is 2-(4-fluorophenyl)ethyl 5-(cyclopropanecarbonylamino)thiophene-2-carboxylate.
| Compound Name | 2-(4-fluorophenyl)ethyl 5-(cyclopropanecarbonylamino)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 86937892 |
| Molecular Formula | C17H16FNO3S |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 2-(4-fluorophenyl)ethyl 5-(cyclopropanecarbonylamino)thiophene-2-carboxylate |
| SMILES | O=C(OCCc1ccc(F)cc1)c1ccc(NC(=O)C2CC2)s1 |
| InChI | InChI=1S/C17H16FNO3S/c18-13-5-1-11(2-6-13)9-10-22-17(21)14-7-8-15(23-14)19-16(20)12-3-4-12/h1-2,5-8,12H,3-4,9-10H2,(H,19,20) |
| InChIKey | ZGVZAZSAVYGONR-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |