C19H25N3O3S2 — CID 16582954
(E)-N-[5-(diethylsulfamoyl)-2,3-dimethylphenyl]-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enamide (PubChem CID 16582954) has the molecular formula C19H25N3O3S2 and a molecular weight of 407.56 g/mol. Its IUPAC name is (E)-N-[5-(diethylsulfamoyl)-2,3-dimethylphenyl]-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enamide.
| Compound Name | (E)-N-[5-(diethylsulfamoyl)-2,3-dimethylphenyl]-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 16582954 |
| Molecular Formula | C19H25N3O3S2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | (E)-N-[5-(diethylsulfamoyl)-2,3-dimethylphenyl]-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C)c(C)c(NC(=O)/C=C/c2csc(C)n2)c1 |
| InChI | InChI=1S/C19H25N3O3S2/c1-6-22(7-2)27(24,25)17-10-13(3)14(4)18(11-17)21-19(23)9-8-16-12-26-15(5)20-16/h8-12H,6-7H2,1-5H3,(H,21,23)/b9-8+ |
| InChIKey | MQTTTZGKUFSOIS-CMDGGOBGSA-N |
| XLogP | 3.75 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|