C19H15N3O3 — CID 16588831
(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl 1H-indazole-3-carboxylate (PubChem CID 16588831) has the molecular formula C19H15N3O3 and a molecular weight of 333.35 g/mol. Its IUPAC name is (5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl 1H-indazole-3-carboxylate.
| Compound Name | (5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl 1H-indazole-3-carboxylate |
|---|---|
| PubChem CID | 16588831 |
| Molecular Formula | C19H15N3O3 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | (5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl 1H-indazole-3-carboxylate |
| SMILES | Cc1oc(-c2ccccc2)nc1COC(=O)c1n[nH]c2ccccc12 |
| InChI | InChI=1S/C19H15N3O3/c1-12-16(20-18(25-12)13-7-3-2-4-8-13)11-24-19(23)17-14-9-5-6-10-15(14)21-22-17/h2-10H,11H2,1H3,(H,21,22) |
| InChIKey | QHCWBIVUYQMYSV-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |