C24H20FN3O4S — CID 16593456
N-[2-[(5Z)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]propanamide (PubChem CID 16593456) has the molecular formula C24H20FN3O4S and a molecular weight of 465.51 g/mol. Its IUPAC name is N-[2-[(5Z)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]propanamide.
| Compound Name | N-[2-[(5Z)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]propanamide |
|---|---|
| PubChem CID | 16593456 |
| Molecular Formula | C24H20FN3O4S |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | N-[2-[(5Z)-5-benzylidene-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]propanamide |
| SMILES | O=C(CCc1ncc(-c2ccc(F)cc2)o1)NCCN1C(=O)S/C(=C\c2ccccc2)C1=O |
| InChI | InChI=1S/C24H20FN3O4S/c25-18-8-6-17(7-9-18)19-15-27-22(32-19)11-10-21(29)26-12-13-28-23(30)20(33-24(28)31)14-16-4-2-1-3-5-16/h1-9,14-15H,10-13H2,(H,26,29)/b20-14- |
| InChIKey | IHYZMKHIIQTNDU-ZHZULCJRSA-N |
| XLogP | 4.27 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|