C24H21FN4O4S — CID 30790584
N-[2-[(5Z)-5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]propanamide (PubChem CID 30790584) has the molecular formula C24H21FN4O4S and a molecular weight of 480.52 g/mol. Its IUPAC name is N-[2-[(5Z)-5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]propanamide.
| Compound Name | N-[2-[(5Z)-5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]propanamide |
|---|---|
| PubChem CID | 30790584 |
| Molecular Formula | C24H21FN4O4S |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | N-[2-[(5Z)-5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]propanamide |
| SMILES | Cc1ccc(-c2noc(CCC(=O)NCCN3C(=O)S/C(=C\c4ccc(F)cc4)C3=O)n2)cc1 |
| InChI | InChI=1S/C24H21FN4O4S/c1-15-2-6-17(7-3-15)22-27-21(33-28-22)11-10-20(30)26-12-13-29-23(31)19(34-24(29)32)14-16-4-8-18(25)9-5-16/h2-9,14H,10-13H2,1H3,(H,26,30)/b19-14- |
| InChIKey | NPMSMDFZPRLURL-RGEXLXHISA-N |
| XLogP | 3.97 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|