About 6-[(2,2,2-trifluoroacetyl)amino]bicyclo[3.1.0]hexane-6-carboxylic acid
6-[(2,2,2-trifluoroacetyl)amino]bicyclo[3.1.0]hexane-6-carboxylic acid (PubChem CID 166000293) has the molecular formula C9H10F3NO3
and a molecular weight of 237.18 g/mol. Its IUPAC name is 6-[(2,2,2-trifluoroacetyl)amino]bicyclo[3.1.0]hexane-6-carboxylic acid.
Molecular Properties
| Compound Name | 6-[(2,2,2-trifluoroacetyl)amino]bicyclo[3.1.0]hexane-6-carboxylic acid |
| PubChem CID | 166000293 |
| Molecular Formula | C9H10F3NO3 |
| Molecular Weight | 237.18 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 6-[(2,2,2-trifluoroacetyl)amino]bicyclo[3.1.0]hexane-6-carboxylic acid |
| SMILES | O=C(NC1(C(=O)O)C2CCCC21)C(F)(F)F |
| InChI | InChI=1S/C9H10F3NO3/c10-9(11,12)6(14)13-8(7(15)16)4-2-1-3-5(4)8/h4-5H,1-3H2,(H,13,14)(H,15,16) |
| InChIKey | WYQXUXIBOGGXTJ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.18 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-[(2,2,2-trifluoroacetyl)amino]bicyclo[3.1.0]hexane-6-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(2,2,2-trifluoroacetyl)amino]bicyclo[3.1.0]hexane-6-carboxylic acid?
The IUPAC name of 6-[(2,2,2-trifluoroacetyl)amino]bicyclo[3.1.0]hexane-6-carboxylic acid (CID 166000293) is 6-[(2,2,2-trifluoroacetyl)amino]bicyclo[3.1.0]hexane-6-carboxylic acid.
What is the SMILES notation for 6-[(2,2,2-trifluoroacetyl)amino]bicyclo[3.1.0]hexane-6-carboxylic acid?
The canonical SMILES for 6-[(2,2,2-trifluoroacetyl)amino]bicyclo[3.1.0]hexane-6-carboxylic acid is O=C(NC1(C(=O)O)C2CCCC21)C(F)(F)F.
What is the InChIKey of 6-[(2,2,2-trifluoroacetyl)amino]bicyclo[3.1.0]hexane-6-carboxylic acid?
The InChIKey is WYQXUXIBOGGXTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10F3NO3/c10-9(11,12)6(14)13-8(7(15)16)4-2-1-3-5(4)8/h4-5H,1-3H2,(H,13,14)(H,15,16).
What are the key properties of 6-[(2,2,2-trifluoroacetyl)amino]bicyclo[3.1.0]hexane-6-carboxylic acid?
6-[(2,2,2-trifluoroacetyl)amino]bicyclo[3.1.0]hexane-6-carboxylic acid has a molecular weight of 237.18 g/mol, XLogP of 0.92, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(2,2,2-trifluoroacetyl)amino]bicyclo[3.1.0]hexane-6-carboxylic acid is sourced from PubChem (CID 166000293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).