C23H22N4O4 — CID 16600316
[3-(2-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl (E)-2-cyano-3-[4-(dimethylamino)phenyl]prop-2-enoate (PubChem CID 16600316) has the molecular formula C23H22N4O4 and a molecular weight of 418.45 g/mol. Its IUPAC name is [3-(2-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl (E)-2-cyano-3-[4-(dimethylamino)phenyl]prop-2-enoate.
| Compound Name | [3-(2-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl (E)-2-cyano-3-[4-(dimethylamino)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 16600316 |
| Molecular Formula | C23H22N4O4 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | [3-(2-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl (E)-2-cyano-3-[4-(dimethylamino)phenyl]prop-2-enoate |
| SMILES | CCOc1ccccc1-c1noc(COC(=O)/C(C#N)=C/c2ccc(N(C)C)cc2)n1 |
| InChI | InChI=1S/C23H22N4O4/c1-4-29-20-8-6-5-7-19(20)22-25-21(31-26-22)15-30-23(28)17(14-24)13-16-9-11-18(12-10-16)27(2)3/h5-13H,4,15H2,1-3H3/b17-13+ |
| InChIKey | KZFNNPIOJPBAAJ-GHRIWEEISA-N |
| XLogP | 3.85 |
| TPSA | 101.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|