C19H26N2O4 — CID 166004643
(4aR)-4-[(5-amino-2,2-dimethyl-3H-1-benzofuran-6-yl)oxy]-3,3-dimethyl-4a,5,6,7-tetrahydro-4H-pyrrolo[1,2-c][1,3]oxazin-1-one (PubChem CID 166004643) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is (4aR)-4-[(5-amino-2,2-dimethyl-3H-1-benzofuran-6-yl)oxy]-3,3-dimethyl-4a,5,6,7-tetrahydro-4H-pyrrolo[1,2-c][1,3]oxazin-1-one.
| Compound Name | (4aR)-4-[(5-amino-2,2-dimethyl-3H-1-benzofuran-6-yl)oxy]-3,3-dimethyl-4a,5,6,7-tetrahydro-4H-pyrrolo[1,2-c][1,3]oxazin-1-one |
|---|---|
| PubChem CID | 166004643 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | (4aR)-4-[(5-amino-2,2-dimethyl-3H-1-benzofuran-6-yl)oxy]-3,3-dimethyl-4a,5,6,7-tetrahydro-4H-pyrrolo[1,2-c][1,3]oxazin-1-one |
| SMILES | CC1(C)Cc2cc(N)c(OC3[C@H]4CCCN4C(=O)OC3(C)C)cc2O1 |
| InChI | InChI=1S/C19H26N2O4/c1-18(2)10-11-8-12(20)15(9-14(11)24-18)23-16-13-6-5-7-21(13)17(22)25-19(16,3)4/h8-9,13,16H,5-7,10,20H2,1-4H3/t13-,16?/m1/s1 |
| InChIKey | NSTPXHASMIWJJZ-JBZHPUCOSA-N |
| XLogP | 3.12 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|