C25H26F3N3O6S2 — CID 166005071
N-[1-[(2R,5R)-5-(hydroxymethyl)-4-[(1S)-1-(methyldisulfanyl)ethoxy]oxolan-2-yl]-2-oxo-5-[3-[(2,2,2-trifluoroacetyl)amino]prop-1-ynyl]-4-pyridinyl]benzamide (PubChem CID 166005071) has the molecular formula C25H26F3N3O6S2 and a molecular weight of 585.63 g/mol. Its IUPAC name is N-[1-[(2R,5R)-5-(hydroxymethyl)-4-[(1S)-1-(methyldisulfanyl)ethoxy]oxolan-2-yl]-2-oxo-5-[3-[(2,2,2-trifluoroacetyl)amino]prop-1-ynyl]-4-pyridinyl]benzamide.
| Compound Name | N-[1-[(2R,5R)-5-(hydroxymethyl)-4-[(1S)-1-(methyldisulfanyl)ethoxy]oxolan-2-yl]-2-oxo-5-[3-[(2,2,2-trifluoroacetyl)amino]prop-1-ynyl]-4-pyridinyl]benzamide |
|---|---|
| PubChem CID | 166005071 |
| Molecular Formula | C25H26F3N3O6S2 |
| Molecular Weight | 585.63 g/mol |
| Exact Mass | 585.12 |
| IUPAC Name | N-[1-[(2R,5R)-5-(hydroxymethyl)-4-[(1S)-1-(methyldisulfanyl)ethoxy]oxolan-2-yl]-2-oxo-5-[3-[(2,2,2-trifluoroacetyl)amino]prop-1-ynyl]-4-pyridinyl]benzamide |
| SMILES | CSS[C@@H](C)OC1C[C@H](n2cc(C#CCNC(=O)C(F)(F)F)c(NC(=O)c3ccccc3)cc2=O)O[C@@H]1CO |
| InChI | InChI=1S/C25H26F3N3O6S2/c1-15(39-38-2)36-19-12-22(37-20(19)14-32)31-13-17(9-6-10-29-24(35)25(26,27)28)18(11-21(31)33)30-23(34)16-7-4-3-5-8-16/h3-5,7-8,11,13,15,19-20,22,32H,10,12,14H2,1-2H3,(H,29,35)(H,30,34)/t15-,19?,20+,22+/m0/s1 |
| InChIKey | FZVFCCGEPSWPFP-YNBPMVEWSA-N |
| XLogP | 3.15 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.63 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|