C25H32O3Si — CID 166005490
[(4S)-7-[tert-butyl(diphenyl)silyl]oxyhept-1-yn-4-yl] acetate (PubChem CID 166005490) has the molecular formula C25H32O3Si and a molecular weight of 408.61 g/mol. Its IUPAC name is [(4S)-7-[tert-butyl(diphenyl)silyl]oxyhept-1-yn-4-yl] acetate.
| Compound Name | [(4S)-7-[tert-butyl(diphenyl)silyl]oxyhept-1-yn-4-yl] acetate |
|---|---|
| PubChem CID | 166005490 |
| Molecular Formula | C25H32O3Si |
| Molecular Weight | 408.61 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | [(4S)-7-[tert-butyl(diphenyl)silyl]oxyhept-1-yn-4-yl] acetate |
| SMILES | C#CC[C@H](CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OC(C)=O |
| InChI | InChI=1S/C25H32O3Si/c1-6-14-22(28-21(2)26)15-13-20-27-29(25(3,4)5,23-16-9-7-10-17-23)24-18-11-8-12-19-24/h1,7-12,16-19,22H,13-15,20H2,2-5H3/t22-/m1/s1 |
| InChIKey | GFHFNRFHVVBRJP-JOCHJYFZSA-N |
| XLogP | 4.30 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.61 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|