C31H24N2O8 — CID 166007053
5-(3-acetyl-4-formyloxybenzoyl)-2-[[4-[4-(methylamino)phenoxy]phenyl]carbamoyl]benzoic acid (PubChem CID 166007053) has the molecular formula C31H24N2O8 and a molecular weight of 552.54 g/mol. Its IUPAC name is 5-(3-acetyl-4-formyloxybenzoyl)-2-[[4-[4-(methylamino)phenoxy]phenyl]carbamoyl]benzoic acid.
| Compound Name | 5-(3-acetyl-4-formyloxybenzoyl)-2-[[4-[4-(methylamino)phenoxy]phenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 166007053 |
| Molecular Formula | C31H24N2O8 |
| Molecular Weight | 552.54 g/mol |
| Exact Mass | 552.15 |
| IUPAC Name | 5-(3-acetyl-4-formyloxybenzoyl)-2-[[4-[4-(methylamino)phenoxy]phenyl]carbamoyl]benzoic acid |
| SMILES | CNc1ccc(Oc2ccc(NC(=O)c3ccc(C(=O)c4ccc(OC=O)c(C(C)=O)c4)cc3C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C31H24N2O8/c1-18(35)26-15-20(4-14-28(26)40-17-34)29(36)19-3-13-25(27(16-19)31(38)39)30(37)33-22-7-11-24(12-8-22)41-23-9-5-21(32-2)6-10-23/h3-17,32H,1-2H3,(H,33,37)(H,38,39) |
| InChIKey | WALPEZXOWDWXAO-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 148.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.54 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|