C44H34F3N3O8 — CID 135299312
5-[2-[4-[[4-(4-aminophenoxy)phenyl]carbamoyl]-3-formyloxyphenyl]-1,1,1-trifluoropropan-2-yl]-2-[[4-(4-methylphenoxy)phenyl]carbamoyl]benzoic acid (PubChem CID 135299312) has the molecular formula C44H34F3N3O8 and a molecular weight of 789.76 g/mol. Its IUPAC name is 5-[2-[4-[[4-(4-aminophenoxy)phenyl]carbamoyl]-3-formyloxyphenyl]-1,1,1-trifluoropropan-2-yl]-2-[[4-(4-methylphenoxy)phenyl]carbamoyl]benzoic acid.
| Compound Name | 5-[2-[4-[[4-(4-aminophenoxy)phenyl]carbamoyl]-3-formyloxyphenyl]-1,1,1-trifluoropropan-2-yl]-2-[[4-(4-methylphenoxy)phenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 135299312 |
| Molecular Formula | C44H34F3N3O8 |
| Molecular Weight | 789.76 g/mol |
| Exact Mass | 789.23 |
| IUPAC Name | 5-[2-[4-[[4-(4-aminophenoxy)phenyl]carbamoyl]-3-formyloxyphenyl]-1,1,1-trifluoropropan-2-yl]-2-[[4-(4-methylphenoxy)phenyl]carbamoyl]benzoic acid |
| SMILES | Cc1ccc(Oc2ccc(NC(=O)c3ccc(C(C)(c4ccc(C(=O)Nc5ccc(Oc6ccc(N)cc6)cc5)c(OC=O)c4)C(F)(F)F)cc3C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C44H34F3N3O8/c1-26-3-13-32(14-4-26)57-34-17-9-30(10-18-34)49-40(52)36-21-5-27(23-38(36)42(54)55)43(2,44(45,46)47)28-6-22-37(39(24-28)56-25-51)41(53)50-31-11-19-35(20-12-31)58-33-15-7-29(48)8-16-33/h3-25H,48H2,1-2H3,(H,49,52)(H,50,53)(H,54,55) |
| InChIKey | PCVYQKSGIOBDCZ-UHFFFAOYSA-N |
| XLogP | 9.77 |
| TPSA | 166.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.76 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|