C42H52BClN2 — CID 166014236
4,27-ditert-butyl-16-chloro-7,12,20,25-tetramethyl-13,19-diaza-1-boranonacyclo[16.12.1.12,6.119,26.07,12.014,31.020,25.013,33.030,32]tritriaconta-2,4,6(33),14,16,18(31),26,28,30(32)-nonaene (PubChem CID 166014236) has the molecular formula C42H52BClN2 and a molecular weight of 631.16 g/mol. Its IUPAC name is 4,27-ditert-butyl-16-chloro-7,12,20,25-tetramethyl-13,19-diaza-1-boranonacyclo[16.12.1.12,6.119,26.07,12.014,31.020,25.013,33.030,32]tritriaconta-2,4,6(33),14,16,18(31),26,28,30(32)-nonaene.
| Compound Name | 4,27-ditert-butyl-16-chloro-7,12,20,25-tetramethyl-13,19-diaza-1-boranonacyclo[16.12.1.12,6.119,26.07,12.014,31.020,25.013,33.030,32]tritriaconta-2,4,6(33),14,16,18(31),26,28,30(32)-nonaene |
|---|---|
| PubChem CID | 166014236 |
| Molecular Formula | C42H52BClN2 |
| Molecular Weight | 631.16 g/mol |
| Exact Mass | 630.39 |
| IUPAC Name | 4,27-ditert-butyl-16-chloro-7,12,20,25-tetramethyl-13,19-diaza-1-boranonacyclo[16.12.1.12,6.119,26.07,12.014,31.020,25.013,33.030,32]tritriaconta-2,4,6(33),14,16,18(31),26,28,30(32)-nonaene |
| SMILES | CC(C)(C)c1cc2c3c(c1)C1(C)CCCCC1(C)N3c1cc(Cl)cc3c1B2c1ccc(C(C)(C)C)c2c1N3C1(C)CCCCC21C |
| InChI | InChI=1S/C42H52BClN2/c1-37(2,3)25-21-28-35-30(22-25)43-29-16-15-27(38(4,5)6)33-36(29)46(42(10)20-14-12-18-40(33,42)8)32-24-26(44)23-31(34(32)43)45(35)41(9)19-13-11-17-39(28,41)7/h15-16,21-24H,11-14,17-20H2,1-10H3 |
| InChIKey | ZILQRVVDRQKBKS-UHFFFAOYSA-N |
| XLogP | 9.56 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.16 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|