C20H37N3O2S — CID 166020088
2-[6-(4-methylsulfonylcyclohexyl)piperazin-2-yl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline (PubChem CID 166020088) has the molecular formula C20H37N3O2S and a molecular weight of 383.60 g/mol. Its IUPAC name is 2-[6-(4-methylsulfonylcyclohexyl)piperazin-2-yl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline.
| Compound Name | 2-[6-(4-methylsulfonylcyclohexyl)piperazin-2-yl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline |
|---|---|
| PubChem CID | 166020088 |
| Molecular Formula | C20H37N3O2S |
| Molecular Weight | 383.60 g/mol |
| Exact Mass | 383.26 |
| IUPAC Name | 2-[6-(4-methylsulfonylcyclohexyl)piperazin-2-yl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline |
| SMILES | CS(=O)(=O)C1CCC(C2CNCC(N3CCC4CCCCC4C3)N2)CC1 |
| InChI | InChI=1S/C20H37N3O2S/c1-26(24,25)18-8-6-16(7-9-18)19-12-21-13-20(22-19)23-11-10-15-4-2-3-5-17(15)14-23/h15-22H,2-14H2,1H3 |
| InChIKey | XRCYLRLBRGWOHJ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.60 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |