C17H32N2O3S2 — CID 166020009
2-(4-methylsulfonylcyclohexyl)-6-[(5-methylthiolan-2-yl)methoxy]piperazine (PubChem CID 166020009) has the molecular formula C17H32N2O3S2 and a molecular weight of 376.59 g/mol. Its IUPAC name is 2-(4-methylsulfonylcyclohexyl)-6-[(5-methylthiolan-2-yl)methoxy]piperazine.
| Compound Name | 2-(4-methylsulfonylcyclohexyl)-6-[(5-methylthiolan-2-yl)methoxy]piperazine |
|---|---|
| PubChem CID | 166020009 |
| Molecular Formula | C17H32N2O3S2 |
| Molecular Weight | 376.59 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 2-(4-methylsulfonylcyclohexyl)-6-[(5-methylthiolan-2-yl)methoxy]piperazine |
| SMILES | CC1CCC(COC2CNCC(C3CCC(S(C)(=O)=O)CC3)N2)S1 |
| InChI | InChI=1S/C17H32N2O3S2/c1-12-3-6-14(23-12)11-22-17-10-18-9-16(19-17)13-4-7-15(8-5-13)24(2,20)21/h12-19H,3-11H2,1-2H3 |
| InChIKey | JTZFQVLIPVPKJI-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.59 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |