C16H31N3O3S2 — CID 156650260
5-(4-methylsulfonylcyclohexyl)-3-(thiolan-2-ylmethoxy)piperazin-2-amine (PubChem CID 156650260) has the molecular formula C16H31N3O3S2 and a molecular weight of 377.58 g/mol. Its IUPAC name is 5-(4-methylsulfonylcyclohexyl)-3-(thiolan-2-ylmethoxy)piperazin-2-amine.
| Compound Name | 5-(4-methylsulfonylcyclohexyl)-3-(thiolan-2-ylmethoxy)piperazin-2-amine |
|---|---|
| PubChem CID | 156650260 |
| Molecular Formula | C16H31N3O3S2 |
| Molecular Weight | 377.58 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | 5-(4-methylsulfonylcyclohexyl)-3-(thiolan-2-ylmethoxy)piperazin-2-amine |
| SMILES | CS(=O)(=O)C1CCC(C2CNC(N)C(OCC3CCCS3)N2)CC1 |
| InChI | InChI=1S/C16H31N3O3S2/c1-24(20,21)13-6-4-11(5-7-13)14-9-18-15(17)16(19-14)22-10-12-3-2-8-23-12/h11-16,18-19H,2-10,17H2,1H3 |
| InChIKey | QHMOLZGNTABASI-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.58 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |