C19H37N3O3S2 — CID 166020077
6-(4-methylsulfonylcyclohexyl)-5-propan-2-yloxy-N-(thiolan-2-ylmethyl)piperazin-2-amine (PubChem CID 166020077) has the molecular formula C19H37N3O3S2 and a molecular weight of 419.66 g/mol. Its IUPAC name is 6-(4-methylsulfonylcyclohexyl)-5-propan-2-yloxy-N-(thiolan-2-ylmethyl)piperazin-2-amine.
| Compound Name | 6-(4-methylsulfonylcyclohexyl)-5-propan-2-yloxy-N-(thiolan-2-ylmethyl)piperazin-2-amine |
|---|---|
| PubChem CID | 166020077 |
| Molecular Formula | C19H37N3O3S2 |
| Molecular Weight | 419.66 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | 6-(4-methylsulfonylcyclohexyl)-5-propan-2-yloxy-N-(thiolan-2-ylmethyl)piperazin-2-amine |
| SMILES | CC(C)OC1NCC(NCC2CCCS2)NC1C1CCC(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C19H37N3O3S2/c1-13(2)25-19-18(14-6-8-16(9-7-14)27(3,23)24)22-17(12-21-19)20-11-15-5-4-10-26-15/h13-22H,4-12H2,1-3H3 |
| InChIKey | PZGQWBMBFMQTKD-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.66 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |