C10H20N4O2S2 — CID 166020144
5-methylsulfonyl-1-(thiolan-2-ylmethyl)-3,3a,4,5,6,6a-hexahydro-2H-imidazo[4,5-c]pyrazole (PubChem CID 166020144) has the molecular formula C10H20N4O2S2 and a molecular weight of 292.43 g/mol. Its IUPAC name is 5-methylsulfonyl-1-(thiolan-2-ylmethyl)-3,3a,4,5,6,6a-hexahydro-2H-imidazo[4,5-c]pyrazole.
| Compound Name | 5-methylsulfonyl-1-(thiolan-2-ylmethyl)-3,3a,4,5,6,6a-hexahydro-2H-imidazo[4,5-c]pyrazole |
|---|---|
| PubChem CID | 166020144 |
| Molecular Formula | C10H20N4O2S2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 5-methylsulfonyl-1-(thiolan-2-ylmethyl)-3,3a,4,5,6,6a-hexahydro-2H-imidazo[4,5-c]pyrazole |
| SMILES | CS(=O)(=O)C1NC2CNN(CC3CCCS3)C2N1 |
| InChI | InChI=1S/C10H20N4O2S2/c1-18(15,16)10-12-8-5-11-14(9(8)13-10)6-7-3-2-4-17-7/h7-13H,2-6H2,1H3 |
| InChIKey | GQRNANJMSPODQX-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |