C17H33FN4O2S — CID 156650287
N-[(5-fluoropiperidin-2-yl)methyl]-6-(4-methylsulfonylcyclohexyl)piperazin-2-amine (PubChem CID 156650287) has the molecular formula C17H33FN4O2S and a molecular weight of 376.54 g/mol. Its IUPAC name is N-[(5-fluoropiperidin-2-yl)methyl]-6-(4-methylsulfonylcyclohexyl)piperazin-2-amine.
| Compound Name | N-[(5-fluoropiperidin-2-yl)methyl]-6-(4-methylsulfonylcyclohexyl)piperazin-2-amine |
|---|---|
| PubChem CID | 156650287 |
| Molecular Formula | C17H33FN4O2S |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | N-[(5-fluoropiperidin-2-yl)methyl]-6-(4-methylsulfonylcyclohexyl)piperazin-2-amine |
| SMILES | CS(=O)(=O)C1CCC(C2CNCC(NCC3CCC(F)CN3)N2)CC1 |
| InChI | InChI=1S/C17H33FN4O2S/c1-25(23,24)15-6-2-12(3-7-15)16-10-19-11-17(22-16)21-9-14-5-4-13(18)8-20-14/h12-17,19-22H,2-11H2,1H3 |
| InChIKey | AEGJUYIVNGPFJN-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |