C18H31NO2S2 — CID 166020141
2-(4-methylsulfonylcyclohexyl)-6-[(Z)-2-(thiolan-2-yl)ethenyl]piperidine (PubChem CID 166020141) has the molecular formula C18H31NO2S2 and a molecular weight of 357.59 g/mol. Its IUPAC name is 2-(4-methylsulfonylcyclohexyl)-6-[(Z)-2-(thiolan-2-yl)ethenyl]piperidine.
| Compound Name | 2-(4-methylsulfonylcyclohexyl)-6-[(Z)-2-(thiolan-2-yl)ethenyl]piperidine |
|---|---|
| PubChem CID | 166020141 |
| Molecular Formula | C18H31NO2S2 |
| Molecular Weight | 357.59 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | 2-(4-methylsulfonylcyclohexyl)-6-[(Z)-2-(thiolan-2-yl)ethenyl]piperidine |
| SMILES | CS(=O)(=O)C1CCC(C2CCCC(/C=C\C3CCCS3)N2)CC1 |
| InChI | InChI=1S/C18H31NO2S2/c1-23(20,21)17-11-7-14(8-12-17)18-6-2-4-15(19-18)9-10-16-5-3-13-22-16/h9-10,14-19H,2-8,11-13H2,1H3/b10-9- |
| InChIKey | SQWJLDKLGNXXOA-KTKRTIGZSA-N |
| XLogP | 3.55 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.59 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|